Products 2545-89-3
CAS 2545-89-3 appears in our catalog under these names: H–Tyr–Glu–OH, H-Tyr-Glu-OH, L-Tyrosyl-L-glutamic acid, 98.15%, H-Tyr-Glu-OH, 97%, L-Tyrosyl-L-glutamic acid, 97%. Offered by: GLPBio, Biosynth, MedChemExpress, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 50mg, 250mg, 500mg, 100 mg, 25 mg.
(2S)-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]pentanedioic acid (CAS 2545-89-3) is a chemical compound with the molecular formula C14H18N2O6 and a molecular weight of 310.30 g/mol. IUPAC name: (2S)-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]pentanedioic acid. InChIKey: PDSLRCZINIDLMU-QWRGUYRKSA-N.
| Molecular formula | C14H18N2O6 |
|---|---|
| Molecular weight | 310.30 g/mol |
| IUPAC name | (2S)-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]pentanedioic acid |
| InChIKey | PDSLRCZINIDLMU-QWRGUYRKSA-N |
| SMILES | C1=CC(=CC=C1C[C@@H](C(=O)N[C@@H](CCC(=O)O)C(=O)O)N)O |
Computed by PubChem (NCBI)