Products 2547-47-9
CAS 2547-47-9 is the registry number for 7,8-Dihydro-7,8-dihydroxykynurenic acid. Offered by: MedChemExpress. Available pack sizes: Get quote.
7,8-dihydro-7,8-dihydroxykynurenic acid is the 7,8-dihydro-7,8-dihydroxy derivative of kynurenic acid. It is functionally related to a kynurenic acid. It is a conjugate acid of a 7,8-dihydro-7,8-dihydroxykynurenate.
Source: ChEBI
| Molecular formula | C10H9NO5 |
|---|---|
| Molecular weight | 223.18 g/mol |
| IUPAC name | 7,8-dihydroxy-4-oxo-7,8-dihydro-1H-quinoline-2-carboxylic acid |
| InChIKey | LLAWHKBFIBTIBH-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(C1O)O)NC(=CC2=O)C(=O)O |
Computed by PubChem (NCBI)