Products 2548968-72-3
CAS 2548968-72-3 is the registry number for (S)-2-Amino-3,3-dicyclopropylpropanoic Acid Hydrochloride, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(2S)-2-amino-3,3-dicyclopropylpropanoic acid;hydrochloride (CAS 2548968-72-3) is a chemical compound with the molecular formula C9H16ClNO2 and a molecular weight of 205.68 g/mol. IUPAC name: (2S)-2-amino-3,3-dicyclopropylpropanoic acid;hydrochloride. InChIKey: QIMYECURUOMVSW-QRPNPIFTSA-N.
| Molecular formula | C9H16ClNO2 |
|---|---|
| Molecular weight | 205.68 g/mol |
| IUPAC name | (2S)-2-amino-3,3-dicyclopropylpropanoic acid;hydrochloride |
| InChIKey | QIMYECURUOMVSW-QRPNPIFTSA-N |
| SMILES | C1CC1C(C2CC2)[C@@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)