CAS 2770352-82-2 is the registry number for 2-Amino-3,3-dicyclopropylpropanoic acid hydrochloride, 97%. Offered by: AmBeed. Available pack sizes: 250mg, 10g.
2-amino-3,3-dicyclopropylpropanoic acid;hydrochloride (CAS 2770352-82-2) is a chemical compound with the molecular formula C9H16ClNO2 and a molecular weight of 205.68 g/mol. IUPAC name: 2-amino-3,3-dicyclopropylpropanoic acid;hydrochloride. InChIKey: QIMYECURUOMVSW-UHFFFAOYSA-N.
| Molecular formula | C9H16ClNO2 |
|---|---|
| Molecular weight | 205.68 g/mol |
| IUPAC name | 2-amino-3,3-dicyclopropylpropanoic acid;hydrochloride |
| InChIKey | QIMYECURUOMVSW-UHFFFAOYSA-N |
| SMILES | C1CC1C(C2CC2)C(C(=O)O)N.Cl |
Computed by PubChem (NCBI)