Products 255829-51-7
CAS 255829-51-7 appears in our catalog under these names: Dopaquinone Impurity 2（Dopaquinone Lactone）, Dopaquinone Lactone. Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
(3S)-3-amino-3,4-dihydrochromene-2,6,7-trione (CAS 255829-51-7) is a chemical compound with the molecular formula C9H7NO4 and a molecular weight of 193.16 g/mol. IUPAC name: (3S)-3-amino-3,4-dihydrochromene-2,6,7-trione. InChIKey: RZTGZIWOVGOFDC-YFKPBYRVSA-N.
| Molecular formula | C9H7NO4 |
|---|---|
| Molecular weight | 193.16 g/mol |
| IUPAC name | (3S)-3-amino-3,4-dihydrochromene-2,6,7-trione |
| InChIKey | RZTGZIWOVGOFDC-YFKPBYRVSA-N |
| SMILES | C1[C@@H](C(=O)OC2=CC(=O)C(=O)C=C21)N |
Computed by PubChem (NCBI)