CAS 2561455-12-5 appears in our catalog under these names: 6-Chloro-2-methylpyrido[3,2-d]pyrimidin-4-amine 95%, 6-Chloro-2-methylpyrido[3,2-d]pyrimidin-4-amine, 95%, 95%, 6-CHLORO-2-METHYLPYRIDO[3,2-D]PYRIMIDIN-4-AMINE, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
6-chloro-2-methylpyrido[3,2-d]pyrimidin-4-amine (CAS 2561455-12-5) is a chemical compound with the molecular formula C8H7ClN4 and a molecular weight of 194.62 g/mol. IUPAC name: 6-chloro-2-methylpyrido[3,2-d]pyrimidin-4-amine. InChIKey: MUSIXQBWJQYRLX-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN4 |
|---|---|
| Molecular weight | 194.62 g/mol |
| IUPAC name | 6-chloro-2-methylpyrido[3,2-d]pyrimidin-4-amine |
| InChIKey | MUSIXQBWJQYRLX-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C(=N1)N)N=C(C=C2)Cl |
Computed by PubChem (NCBI)