Products 256935-99-6
CAS 256935-99-6 appears in our catalog under these names: 7-Fluoroindole-5-carboxylic Acid, ≥97-<99%, 7-Fluoroindole-5-carboxylic Acid, 95-<97%, 7-Fluoro-1H-indole-5-carboxylic acid, 97%, 7-Fluoro-1H-indole-5-carboxylic acid. Offered by: Hoffman Fine Chemicals, AmBeed, Biosynth. Available pack sizes: 500mg, 1g, 2,5g, 5g, 10g, 0,5g, 50mg.
7-fluoro-1H-indole-5-carboxylic acid (CAS 256935-99-6) is a chemical compound with the molecular formula C9H6FNO2 and a molecular weight of 179.15 g/mol. IUPAC name: 7-fluoro-1H-indole-5-carboxylic acid. InChIKey: MYXBVKCHUTXDAR-UHFFFAOYSA-N.
| Molecular formula | C9H6FNO2 |
|---|---|
| Molecular weight | 179.15 g/mol |
| IUPAC name | 7-fluoro-1H-indole-5-carboxylic acid |
| InChIKey | MYXBVKCHUTXDAR-UHFFFAOYSA-N |
| SMILES | C1=CNC2=C(C=C(C=C21)C(=O)O)F |
Computed by PubChem (NCBI)