CAS 25695-77-6 appears in our catalog under these names: Phenyl (E)-3-phenylacrylate, 98%, Phenyl (E)–Cinnamate, Phenyl (E)-Cinnamate, >98.0%(GC), Phenyl (E)-3-phenylacrylate. Offered by: AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 100mg, 1g, 200mg, 5g, 50mg.
Phenyl (E)-3-phenylprop-2-enoate (CAS 25695-77-6) is a chemical compound with the molecular formula C15H12O2 and a molecular weight of 224.25 g/mol. IUPAC name: phenyl (E)-3-phenylprop-2-enoate. InChIKey: NBFNGRDFKUJVIN-VAWYXSNFSA-N.
| Molecular formula | C15H12O2 |
|---|---|
| Molecular weight | 224.25 g/mol |
| IUPAC name | phenyl (E)-3-phenylprop-2-enoate |
| InChIKey | NBFNGRDFKUJVIN-VAWYXSNFSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C(=O)OC2=CC=CC=C2 |
Computed by PubChem (NCBI)