Products 2580234-40-6
CAS 2580234-40-6 appears in our catalog under these names: 5-bromo-3-{[(tert-butoxy)carbonyl]amino}-2-methylbenzoic acid, 97%, 97%, 5-Bromo-3-((tert-butoxycarbonyl)amino)-2-methylbenzoic acid, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
5-bromo-2-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid (CAS 2580234-40-6) is a chemical compound with the molecular formula C13H16BrNO4 and a molecular weight of 330.17 g/mol. IUPAC name: 5-bromo-2-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid. InChIKey: BWRKTSIOBSDYSB-UHFFFAOYSA-N.
| Molecular formula | C13H16BrNO4 |
|---|---|
| Molecular weight | 330.17 g/mol |
| IUPAC name | 5-bromo-2-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid |
| InChIKey | BWRKTSIOBSDYSB-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1NC(=O)OC(C)(C)C)Br)C(=O)O |
Computed by PubChem (NCBI)