Products 2581113-51-9
CAS 2581113-51-9 is the registry number for hMAO-B-IN-3. Offered by: MedChemExpress. Available pack sizes: Get quote.
Benzyl (2E,4E)-5-(1,3-benzodioxol-5-yl)-2-cyanopenta-2,4-dienoate (CAS 2581113-51-9) is a chemical compound with the molecular formula C20H15NO4 and a molecular weight of 333.3 g/mol. IUPAC name: benzyl (2E,4E)-5-(1,3-benzodioxol-5-yl)-2-cyanopenta-2,4-dienoate. InChIKey: CLKKKMAMQMSUHK-AQHRCUNFSA-N.
| Molecular formula | C20H15NO4 |
|---|---|
| Molecular weight | 333.3 g/mol |
| IUPAC name | benzyl (2E,4E)-5-(1,3-benzodioxol-5-yl)-2-cyanopenta-2,4-dienoate |
| InChIKey | CLKKKMAMQMSUHK-AQHRCUNFSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)/C=C/C=C(\C#N)/C(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)
Synonyms:
hMAO-B-IN-3, orb1689034