CAS 25814-13-5 appears in our catalog under these names: 2-(4-Amino-3-chlorophenyl)butanoic acid, 95%, 2-(4-Amino-3-chlorophenyl)butanoic acid, 97%, 2–(4–Amino–3–chlorophenyl)butanoic acid. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 100mg, 250mg.
2-(4-amino-3-chlorophenyl)butanoic acid (CAS 25814-13-5) is a chemical compound with the molecular formula C10H12ClNO2 and a molecular weight of 213.66 g/mol. IUPAC name: 2-(4-amino-3-chlorophenyl)butanoic acid. InChIKey: APKGOXFOTBQTLW-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO2 |
|---|---|
| Molecular weight | 213.66 g/mol |
| IUPAC name | 2-(4-amino-3-chlorophenyl)butanoic acid |
| InChIKey | APKGOXFOTBQTLW-UHFFFAOYSA-N |
| SMILES | CCC(C1=CC(=C(C=C1)N)Cl)C(=O)O |
Computed by PubChem (NCBI)