Products 2582-86-7
CAS 2582-86-7 is the registry number for Atrovenetin. Offered by: MedChemExpress. Available pack sizes: Get quote.
(9R)-4,5,6,7-tetrahydroxy-1,8,8,9-tetramethyl-9H-phenaleno[1,2-b]furan-3-one (CAS 2582-86-7) is a chemical compound with the molecular formula C19H18O6 and a molecular weight of 342.3 g/mol. IUPAC name: (9R)-4,5,6,7-tetrahydroxy-1,8,8,9-tetramethyl-9H-phenaleno[1,2-b]furan-3-one. InChIKey: BTQBPLOITIIODY-SSDOTTSWSA-N.
| Molecular formula | C19H18O6 |
|---|---|
| Molecular weight | 342.3 g/mol |
| IUPAC name | (9R)-4,5,6,7-tetrahydroxy-1,8,8,9-tetramethyl-9H-phenaleno[1,2-b]furan-3-one |
| InChIKey | BTQBPLOITIIODY-SSDOTTSWSA-N |
| SMILES | C[C@@H]1C(C2=C(C3=C4C(=C2O1)C(=CC(=O)C4=C(C(=C3O)O)O)C)O)(C)C |
Computed by PubChem (NCBI)