Products 258273-32-4
CAS 258273-32-4 appears in our catalog under these names: 3-Cyano-4-ethoxybenzoic acid, 3–Cyano–4–ethoxybenzoic acid, 3-cyano-4-ethoxybenzoic acid, 96%, 3-Cyano-4-ethoxybenzoic acid, 98%, 3-Cyano-4-ethoxybenzoic acid, 98%, 98%. Offered by: Chemat Brand, GLPBio, Combi-blocks, Fluorochem, Chemat. Available pack sizes: on request, 100mg, 10g, 5g, 1g, 25g, 250mg.
3-cyano-4-ethoxybenzoic acid (CAS 258273-32-4) is a chemical compound with the molecular formula C10H9NO3 and a molecular weight of 191.18 g/mol. IUPAC name: 3-cyano-4-ethoxybenzoic acid. InChIKey: PNGOHGRLVRKADR-UHFFFAOYSA-N.
| Molecular formula | C10H9NO3 |
|---|---|
| Molecular weight | 191.18 g/mol |
| IUPAC name | 3-cyano-4-ethoxybenzoic acid |
| InChIKey | PNGOHGRLVRKADR-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C=C1)C(=O)O)C#N |
Computed by PubChem (NCBI)