Products 260359-14-6
CAS 260359-14-6 is the registry number for 1H-Indene-1，2(3H)-dione- 5，6-difluoro- 2-oxime, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g, 25g.
(2E)-5,6-difluoro-2-hydroxyimino-3H-inden-1-one (CAS 260359-14-6) is a chemical compound with the molecular formula C9H5F2NO2 and a molecular weight of 197.14 g/mol. IUPAC name: (2E)-5,6-difluoro-2-hydroxyimino-3H-inden-1-one. InChIKey: BYYGMUGRXMVSNS-XYOKQWHBSA-N.
| Molecular formula | C9H5F2NO2 |
|---|---|
| Molecular weight | 197.14 g/mol |
| IUPAC name | (2E)-5,6-difluoro-2-hydroxyimino-3H-inden-1-one |
| InChIKey | BYYGMUGRXMVSNS-XYOKQWHBSA-N |
| SMILES | C\1C2=CC(=C(C=C2C(=O)/C1=N/O)F)F |
Computed by PubChem (NCBI)