Products 2608907-04-4
CAS 2608907-04-4 is the registry number for 4-tert-Butyl 7-methyl 6-oxo-4-azaspiro[2.5]octane-4,7-dicarboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g.
4-O-tert-butyl 7-O-methyl 6-oxo-4-azaspiro[2.5]octane-4,7-dicarboxylate (CAS 2608907-04-4) is a chemical compound with the molecular formula C14H21NO5 and a molecular weight of 283.32 g/mol. IUPAC name: 4-O-tert-butyl 7-O-methyl 6-oxo-4-azaspiro[2.5]octane-4,7-dicarboxylate. InChIKey: DGEQNUNQHSMCAG-UHFFFAOYSA-N.
| Molecular formula | C14H21NO5 |
|---|---|
| Molecular weight | 283.32 g/mol |
| IUPAC name | 4-O-tert-butyl 7-O-methyl 6-oxo-4-azaspiro[2.5]octane-4,7-dicarboxylate |
| InChIKey | DGEQNUNQHSMCAG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(=O)C(CC12CC2)C(=O)OC |
Computed by PubChem (NCBI)