Products 260968-81-8
CAS 260968-81-8 is the registry number for Methyl 4-(chlorosulfonyl)-3-methylbenzoate, 95%. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 50mg, 100mg, 500mg.
Methyl 4-chlorosulfonyl-3-methylbenzoate (CAS 260968-81-8) is a chemical compound with the molecular formula C9H9ClO4S and a molecular weight of 248.68 g/mol. IUPAC name: methyl 4-chlorosulfonyl-3-methylbenzoate. InChIKey: GESFZPOWQXMAKN-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO4S |
|---|---|
| Molecular weight | 248.68 g/mol |
| IUPAC name | methyl 4-chlorosulfonyl-3-methylbenzoate |
| InChIKey | GESFZPOWQXMAKN-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C(=O)OC)S(=O)(=O)Cl |
Computed by PubChem (NCBI)