Products 261522-33-2
CAS 261522-33-2 appears in our catalog under these names: Fmoc-Dehydroxyserine, Fmoc–Dha–OH, Fmoc-Dha-OH 98%, 2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)acrylic acid, 98%, 98%, Fmoc-Dha-OH, 99.85%. Offered by: Chemat Brand, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: on request, 10mg, 100mg, 250mg, 1g, 5g, 10 mg, 50 mg.
2-(9H-fluoren-9-ylmethoxycarbonylamino)prop-2-enoic acid (CAS 261522-33-2) is a chemical compound with the molecular formula C18H15NO4 and a molecular weight of 309.3 g/mol. IUPAC name: 2-(9H-fluoren-9-ylmethoxycarbonylamino)prop-2-enoic acid. InChIKey: DIKJMEPNMBFUQV-UHFFFAOYSA-N.
| Molecular formula | C18H15NO4 |
|---|---|
| Molecular weight | 309.3 g/mol |
| IUPAC name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)prop-2-enoic acid |
| InChIKey | DIKJMEPNMBFUQV-UHFFFAOYSA-N |
| SMILES | C=C(C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)
Synonyms:
Fmoc-Dha-OH, 2-(((9H-fluoren-9-yl)methoxy)carbonylamino)acrylic acid, 2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)acrylic acid, 2-(Fmoc-amino)acrylic Acid, 2-(9H-fluoren-9-ylmethoxycarbonylamino)prop-2-enoic acid, Fmoc-Dehydroxyserine, Fmoc-dehydro-Ala-OH, Fmoc-2-aminoacrylic acid, orb1685681, N-Fmoc-2-amino-2-propenoic acid