Products 261635-92-1
CAS 261635-92-1 is the registry number for Ethyl 6-methoxy-2-(trifluoromethyl)nicotinate, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Ethyl 6-methoxy-2-(trifluoromethyl)pyridine-3-carboxylate (CAS 261635-92-1) is a chemical compound with the molecular formula C10H10F3NO3 and a molecular weight of 249.19 g/mol. IUPAC name: ethyl 6-methoxy-2-(trifluoromethyl)pyridine-3-carboxylate. InChIKey: UXQHSHIZZNMPSD-UHFFFAOYSA-N.
| Molecular formula | C10H10F3NO3 |
|---|---|
| Molecular weight | 249.19 g/mol |
| IUPAC name | ethyl 6-methoxy-2-(trifluoromethyl)pyridine-3-carboxylate |
| InChIKey | UXQHSHIZZNMPSD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=C(C=C1)OC)C(F)(F)F |
Computed by PubChem (NCBI)