CAS 2616727-88-7 is the registry number for 1,2,3,4-Tetrahydro-2,6-naphthyridine-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1,2,3,4-tetrahydro-2,6-naphthyridine-3-carboxylic acid (CAS 2616727-88-7) is a chemical compound with the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. IUPAC name: 1,2,3,4-tetrahydro-2,6-naphthyridine-3-carboxylic acid. InChIKey: GQDGUWUZRNZICA-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O2 |
|---|---|
| Molecular weight | 178.19 g/mol |
| IUPAC name | 1,2,3,4-tetrahydro-2,6-naphthyridine-3-carboxylic acid |
| InChIKey | GQDGUWUZRNZICA-UHFFFAOYSA-N |
| SMILES | C1C(NCC2=C1C=NC=C2)C(=O)O |
Computed by PubChem (NCBI)