Products 2618349-27-0
CAS 2618349-27-0 is the registry number for 3-(5-Aminobenzo[d]isoxazol-3-yl)piperidine-2,6-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(5-amino-1,2-benzoxazol-3-yl)piperidine-2,6-dione (CAS 2618349-27-0) is a chemical compound with the molecular formula C12H11N3O3 and a molecular weight of 245.23 g/mol. IUPAC name: 3-(5-amino-1,2-benzoxazol-3-yl)piperidine-2,6-dione. InChIKey: JMYNHZFJDDTSIP-UHFFFAOYSA-N.
| Molecular formula | C12H11N3O3 |
|---|---|
| Molecular weight | 245.23 g/mol |
| IUPAC name | 3-(5-amino-1,2-benzoxazol-3-yl)piperidine-2,6-dione |
| InChIKey | JMYNHZFJDDTSIP-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1C2=NOC3=C2C=C(C=C3)N |
Computed by PubChem (NCBI)