CAS 26209-41-6 appears in our catalog under these names: (1S,2R,3R,8S)-4-Cyanocubane-1-carboxylic acid, 95%, 4-Cyanocubane-1-carboxylic acid, 95-<97%, (1S,2R,3R,8S)-4-Cyanocubane-1-carboxylic acid, 98%. Offered by: Combi-blocks, Hoffman Fine Chemicals, AmBeed. Available pack sizes: 1g, 250mg, 100mg, 500mg, 2,5g, 5g.
4-cyanocubane-1-carboxylic acid (CAS 26209-41-6) is a chemical compound with the molecular formula C10H7NO2 and a molecular weight of 173.17 g/mol. IUPAC name: 4-cyanocubane-1-carboxylic acid. InChIKey: PXXCZZGKJNAFTD-UHFFFAOYSA-N.
| Molecular formula | C10H7NO2 |
|---|---|
| Molecular weight | 173.17 g/mol |
| IUPAC name | 4-cyanocubane-1-carboxylic acid |
| InChIKey | PXXCZZGKJNAFTD-UHFFFAOYSA-N |
| SMILES | C(#N)C12C3C4C1C5C2C3C45C(=O)O |
Computed by PubChem (NCBI)