Products 262856-84-8
CAS 262856-84-8 is the registry number for a-L-Galactose-1-phosphate dipotassium salt. Offered by: Biosynth. Available pack sizes: 2mg, 1mg, 5mg, 25mg, 10mg.
Dipotassium;[(2S,3S,4R,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] phosphate (CAS 262856-84-8) is a chemical compound with the molecular formula C6H11K2O9P and a molecular weight of 336.32 g/mol. IUPAC name: dipotassium;[(2S,3S,4R,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] phosphate. InChIKey: KCIDZIIHRGYJAE-VMKIRZOFSA-L.
| Molecular formula | C6H11K2O9P |
|---|---|
| Molecular weight | 336.32 g/mol |
| IUPAC name | dipotassium;[(2S,3S,4R,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] phosphate |
| InChIKey | KCIDZIIHRGYJAE-VMKIRZOFSA-L |
| SMILES | C([C@H]1[C@H]([C@H]([C@@H]([C@@H](O1)OP(=O)([O-])[O-])O)O)O)O.[K+].[K+] |
Computed by PubChem (NCBI)