CAS 478518-78-4 appears in our catalog under these names: Galactose 1–phosphate–13C potassium, Galactose 1-phosphate-13C (potassium), ≥99 atom% 13C,≥98%, ≥99 atom% 13C,≥98%, Galactose 1-phosphate-13C (potassium), 98.8%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 5 mg, 1 mg, 10 mg.
Dipotassium;[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)(213C)oxan-2-yl] phosphate (CAS 478518-78-4) is a chemical compound with the molecular formula C6H11K2O9P and a molecular weight of 337.31 g/mol. IUPAC name: dipotassium;[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)(213C)oxan-2-yl] phosphate. InChIKey: KCIDZIIHRGYJAE-HLZBLTOGSA-L.
| Molecular formula | C6H11K2O9P |
|---|---|
| Molecular weight | 337.31 g/mol |
| IUPAC name | dipotassium;[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)(213C)oxan-2-yl] phosphate |
| InChIKey | KCIDZIIHRGYJAE-HLZBLTOGSA-L |
| SMILES | C([C@@H]1[C@@H]([C@@H]([C@H]([13C@H](O1)OP(=O)([O-])[O-])O)O)O)O.[K+].[K+] |
Computed by PubChem (NCBI)