CAS 29732-59-0 is the registry number for Glucose 1-phosphate dipotassium dihydrate. Offered by: Biosynth. Available pack sizes: 5g, 1g, 10g, 25g.
Dipotassium;[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] phosphate (CAS 29732-59-0) is a chemical compound with the molecular formula C6H11K2O9P and a molecular weight of 336.32 g/mol. IUPAC name: dipotassium;[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] phosphate. InChIKey: KCIDZIIHRGYJAE-UHFFFAOYSA-L.
| Molecular formula | C6H11K2O9P |
|---|---|
| Molecular weight | 336.32 g/mol |
| IUPAC name | dipotassium;[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] phosphate |
| InChIKey | KCIDZIIHRGYJAE-UHFFFAOYSA-L |
| SMILES | C(C1C(C(C(C(O1)OP(=O)([O-])[O-])O)O)O)O.[K+].[K+] |
Computed by PubChem (NCBI)