Products 2639623-14-4
CAS 2639623-14-4 is the registry number for (3S)-4-{[(9H-fluoren-9-yl)methoxy]carbonyl}-1,4-oxazepane-3-carboxylic acid, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(3S)-4-(9H-fluoren-9-ylmethoxycarbonyl)-1,4-oxazepane-3-carboxylic acid (CAS 2639623-14-4) is a chemical compound with the molecular formula C21H21NO5 and a molecular weight of 367.4 g/mol. IUPAC name: (3S)-4-(9H-fluoren-9-ylmethoxycarbonyl)-1,4-oxazepane-3-carboxylic acid. InChIKey: OZGBLNJLPOQUEL-IBGZPJMESA-N.
| Molecular formula | C21H21NO5 |
|---|---|
| Molecular weight | 367.4 g/mol |
| IUPAC name | (3S)-4-(9H-fluoren-9-ylmethoxycarbonyl)-1,4-oxazepane-3-carboxylic acid |
| InChIKey | OZGBLNJLPOQUEL-IBGZPJMESA-N |
| SMILES | C1CN([C@@H](COC1)C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)