CAS 26422-92-4 appears in our catalog under these names: Bis(4–methylpyridin–2–yl)amine, Bis(4-methylpyridin-2-yl)amine, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.
4-methyl-N-(4-methyl-2-pyridinyl)pyridin-2-amine (CAS 26422-92-4) is a chemical compound with the molecular formula C12H13N3 and a molecular weight of 199.25 g/mol. IUPAC name: 4-methyl-N-(4-methyl-2-pyridinyl)pyridin-2-amine. InChIKey: PBZBCAUUAFJNFH-UHFFFAOYSA-N.
| Molecular formula | C12H13N3 |
|---|---|
| Molecular weight | 199.25 g/mol |
| IUPAC name | 4-methyl-N-(4-methyl-2-pyridinyl)pyridin-2-amine |
| InChIKey | PBZBCAUUAFJNFH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC=C1)NC2=NC=CC(=C2)C |
Computed by PubChem (NCBI)