Products 2648956-58-3
CAS 2648956-58-3 is the registry number for Methyl 1-(3-Cyanophenyl)-1H-pyrazole-3-carboxylate, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Methyl 1-(3-cyanophenyl)pyrazole-3-carboxylate (CAS 2648956-58-3) is a chemical compound with the molecular formula C12H9N3O2 and a molecular weight of 227.22 g/mol. IUPAC name: methyl 1-(3-cyanophenyl)pyrazole-3-carboxylate. InChIKey: MDRUUHAJMYEYQG-UHFFFAOYSA-N.
| Molecular formula | C12H9N3O2 |
|---|---|
| Molecular weight | 227.22 g/mol |
| IUPAC name | methyl 1-(3-cyanophenyl)pyrazole-3-carboxylate |
| InChIKey | MDRUUHAJMYEYQG-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NN(C=C1)C2=CC=CC(=C2)C#N |
Computed by PubChem (NCBI)