CAS 2656-08-8 is the registry number for N'-(3-Hydroxyphenyl)-N,N-dimethylformamidine hydrochloride. Offered by: HPC Standards. Available pack sizes: 1x10mg.
N'-(3-hydroxyphenyl)-N,N-dimethylmethanimidamide;hydrochloride (CAS 2656-08-8) is a chemical compound with the molecular formula C9H13ClN2O and a molecular weight of 200.66 g/mol. IUPAC name: N'-(3-hydroxyphenyl)-N,N-dimethylmethanimidamide;hydrochloride. InChIKey: BHPGWMKWUGFHJQ-UHFFFAOYSA-N.
| Molecular formula | C9H13ClN2O |
|---|---|
| Molecular weight | 200.66 g/mol |
| IUPAC name | N'-(3-hydroxyphenyl)-N,N-dimethylmethanimidamide;hydrochloride |
| InChIKey | BHPGWMKWUGFHJQ-UHFFFAOYSA-N |
| SMILES | CN(C)C=NC1=CC(=CC=C1)O.Cl |
Computed by PubChem (NCBI)