CAS 266360-60-5 appears in our catalog under these names: (R)–2–Amino–3–(2,4–difluorophenyl)propanoic acid, (R)-2-Amino-3-(2,4-difluorophenyl)propanoic acid, 98%, 98%, (R)-2-Amino-3-(2,4-difluorophenyl)propanoic acid, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g.
(2R)-2-amino-3-(2,4-difluorophenyl)propanoic acid (CAS 266360-60-5) is a chemical compound with the molecular formula C9H9F2NO2 and a molecular weight of 201.17 g/mol. IUPAC name: (2R)-2-amino-3-(2,4-difluorophenyl)propanoic acid. InChIKey: UEFLPVKMPDEMFW-MRVPVSSYSA-N.
| Molecular formula | C9H9F2NO2 |
|---|---|
| Molecular weight | 201.17 g/mol |
| IUPAC name | (2R)-2-amino-3-(2,4-difluorophenyl)propanoic acid |
| InChIKey | UEFLPVKMPDEMFW-MRVPVSSYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)C[C@H](C(=O)O)N |
Computed by PubChem (NCBI)