Products 32133-35-0
CAS 32133-35-0 appears in our catalog under these names: 2,4-Difluoro-dl-phenylalanine, 97%, 2-Amino-3-(2,4-difluorophenyl)propanoic acid, 98%, dl-2,4-Difluorophenylalanine, 97%, 2-Amino-3-(2,4-difluorophenyl)propanoic acid. Offered by: Combi-blocks, AmBeed, Fluorochem, Chemat. Available pack sizes: 5g, 1g, 250mg, 500mg.
2-amino-3-(2,4-difluorophenyl)propanoic acid (CAS 32133-35-0) is a chemical compound with the molecular formula C9H9F2NO2 and a molecular weight of 201.17 g/mol. IUPAC name: 2-amino-3-(2,4-difluorophenyl)propanoic acid. InChIKey: UEFLPVKMPDEMFW-UHFFFAOYSA-N.
| Molecular formula | C9H9F2NO2 |
|---|---|
| Molecular weight | 201.17 g/mol |
| IUPAC name | 2-amino-3-(2,4-difluorophenyl)propanoic acid |
| InChIKey | UEFLPVKMPDEMFW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)CC(C(=O)O)N |
Computed by PubChem (NCBI)