CAS 26638-56-2 is the registry number for Tianeptine Impurity 13. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
6-methyl-5,5-dioxo-11H-benzo[c][1,2]benzothiazepin-11-ol (CAS 26638-56-2) is a chemical compound with the molecular formula C14H13NO3S and a molecular weight of 275.32 g/mol. IUPAC name: 6-methyl-5,5-dioxo-11H-benzo[c][1,2]benzothiazepin-11-ol. InChIKey: UOFSLQBECAIORT-UHFFFAOYSA-N.
| Molecular formula | C14H13NO3S |
|---|---|
| Molecular weight | 275.32 g/mol |
| IUPAC name | 6-methyl-5,5-dioxo-11H-benzo[c][1,2]benzothiazepin-11-ol |
| InChIKey | UOFSLQBECAIORT-UHFFFAOYSA-N |
| SMILES | CN1C2=CC=CC=C2C(C3=CC=CC=C3S1(=O)=O)O |
Computed by PubChem (NCBI)