CAS 26664-02-8 is the registry number for 4,5-Dihydronaphtho(2,1-d)isoxazole-3-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g.
4,5-dihydrobenzo[g][1,2]benzoxazole-3-carboxylic acid (CAS 26664-02-8) is a chemical compound with the molecular formula C12H9NO3 and a molecular weight of 215.20 g/mol. IUPAC name: 4,5-dihydrobenzo[g][1,2]benzoxazole-3-carboxylic acid. InChIKey: OSRPSNRZOFWYFX-UHFFFAOYSA-N.
| Molecular formula | C12H9NO3 |
|---|---|
| Molecular weight | 215.20 g/mol |
| IUPAC name | 4,5-dihydrobenzo[g][1,2]benzoxazole-3-carboxylic acid |
| InChIKey | OSRPSNRZOFWYFX-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C3=CC=CC=C31)ON=C2C(=O)O |
Computed by PubChem (NCBI)