Products 2666965-26-8
CAS 2666965-26-8 is the registry number for 3-(3,4-Difluoro-2-methylphenyl)-2-oxopropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(3,4-difluoro-2-methylphenyl)-2-oxopropanoic acid (CAS 2666965-26-8) is a chemical compound with the molecular formula C10H8F2O3 and a molecular weight of 214.16 g/mol. IUPAC name: 3-(3,4-difluoro-2-methylphenyl)-2-oxopropanoic acid. InChIKey: CBBGESCYLWTNKO-UHFFFAOYSA-N.
| Molecular formula | C10H8F2O3 |
|---|---|
| Molecular weight | 214.16 g/mol |
| IUPAC name | 3-(3,4-difluoro-2-methylphenyl)-2-oxopropanoic acid |
| InChIKey | CBBGESCYLWTNKO-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1F)F)CC(=O)C(=O)O |
Computed by PubChem (NCBI)