CAS 26673-32-5 appears in our catalog under these names: 7-Chloro-1-tetralone, 97%, 7–Chloro–1–tetralone, 7-Chloro-1-tetralone, >95.0%(GC), 7-Chloro-3,4-dihydronaphthalen-1(2H)-one 98%, 7-Chloro-1-tetralone, 98%, 98%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 25g, 5g, 100g, 1g, 500g, 250mg, 10g, 50g.
7-chloro-3,4-dihydro-2H-naphthalen-1-one (CAS 26673-32-5) is a chemical compound with the molecular formula C10H9ClO and a molecular weight of 180.63 g/mol. IUPAC name: 7-chloro-3,4-dihydro-2H-naphthalen-1-one. InChIKey: IIMAYXKDBHTQHC-UHFFFAOYSA-N.
| Molecular formula | C10H9ClO |
|---|---|
| Molecular weight | 180.63 g/mol |
| IUPAC name | 7-chloro-3,4-dihydro-2H-naphthalen-1-one |
| InChIKey | IIMAYXKDBHTQHC-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=C(C=C2)Cl)C(=O)C1 |
Computed by PubChem (NCBI)