Products 2673370-68-6
CAS 2673370-68-6 is the registry number for (S)-2-Amino-8-methyl-7,8-dihydro-5H-pyrano[4,3-b]pyridin-5-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(8S)-2-amino-8-methyl-7,8-dihydropyrano[4,3-b]pyridin-5-one (CAS 2673370-68-6) is a chemical compound with the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. IUPAC name: (8S)-2-amino-8-methyl-7,8-dihydropyrano[4,3-b]pyridin-5-one. InChIKey: OLVCNXKPSXFXBY-RXMQYKEDSA-N.
| Molecular formula | C9H10N2O2 |
|---|---|
| Molecular weight | 178.19 g/mol |
| IUPAC name | (8S)-2-amino-8-methyl-7,8-dihydropyrano[4,3-b]pyridin-5-one |
| InChIKey | OLVCNXKPSXFXBY-RXMQYKEDSA-N |
| SMILES | C[C@@H]1COC(=O)C2=C1N=C(C=C2)N |
Computed by PubChem (NCBI)