Products 2676866-22-9
CAS 2676866-22-9 is the registry number for 3-Isopropyl-6-(trifluoromethyl)pyridin-2-amine, 97%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 250mg, 1g, 100mg.
3-propan-2-yl-6-(trifluoromethyl)pyridin-2-amine (CAS 2676866-22-9) is a chemical compound with the molecular formula C9H11F3N2 and a molecular weight of 204.19 g/mol. IUPAC name: 3-propan-2-yl-6-(trifluoromethyl)pyridin-2-amine. InChIKey: LLLPMBBOCDVXRP-UHFFFAOYSA-N.
| Molecular formula | C9H11F3N2 |
|---|---|
| Molecular weight | 204.19 g/mol |
| IUPAC name | 3-propan-2-yl-6-(trifluoromethyl)pyridin-2-amine |
| InChIKey | LLLPMBBOCDVXRP-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(N=C(C=C1)C(F)(F)F)N |
Computed by PubChem (NCBI)