Products 2680614-87-1
CAS 2680614-87-1 appears in our catalog under these names: 1-(1-Phenyl-1H-pyrazol-5-yl)methanamine hydrochloride, 95%, (1-Phenyl-1H-pyrazol-5-yl)methanamine hydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 100mg.
(2-phenylpyrazol-3-yl)methanamine;hydrochloride (CAS 2680614-87-1) is a chemical compound with the molecular formula C10H12ClN3 and a molecular weight of 209.67 g/mol. IUPAC name: (2-phenylpyrazol-3-yl)methanamine;hydrochloride. InChIKey: BQALBWYSNNODTQ-UHFFFAOYSA-N.
| Molecular formula | C10H12ClN3 |
|---|---|
| Molecular weight | 209.67 g/mol |
| IUPAC name | (2-phenylpyrazol-3-yl)methanamine;hydrochloride |
| InChIKey | BQALBWYSNNODTQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=CC=N2)CN.Cl |
Computed by PubChem (NCBI)