Products 2682112-68-9
CAS 2682112-68-9 is the registry number for 2-(6-(Dimethylamino)pyridin-3-yl)acetic acid hydrochloride, 95%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 250mg, 1g, 100mg.
2-[6-(dimethylamino)-3-pyridinyl]acetic acid;hydrochloride (CAS 2682112-68-9) is a chemical compound with the molecular formula C9H13ClN2O2 and a molecular weight of 216.66 g/mol. IUPAC name: 2-[6-(dimethylamino)-3-pyridinyl]acetic acid;hydrochloride. InChIKey: HBKQKYAGQVAVEE-UHFFFAOYSA-N.
| Molecular formula | C9H13ClN2O2 |
|---|---|
| Molecular weight | 216.66 g/mol |
| IUPAC name | 2-[6-(dimethylamino)-3-pyridinyl]acetic acid;hydrochloride |
| InChIKey | HBKQKYAGQVAVEE-UHFFFAOYSA-N |
| SMILES | CN(C)C1=NC=C(C=C1)CC(=O)O.Cl |
Computed by PubChem (NCBI)