CAS 268734-34-5 appears in our catalog under these names: Methyl 4–cyano–3–fluorobenzoate, Methyl 4-cyano-3-fluorobenzoate, Methyl 4-cyano-3-fluorobenzoate 97%, Methyl 4-cyano-3-fluorobenzoate, 97%, 97%, Methyl 4-cyano-3-fluorobenzoate, 95%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 1g, 25g, 5g, 50g, 250mg, 10g, 100mg.
Methyl 4-cyano-3-fluorobenzoate (CAS 268734-34-5) is a chemical compound with the molecular formula C9H6FNO2 and a molecular weight of 179.15 g/mol. IUPAC name: methyl 4-cyano-3-fluorobenzoate. InChIKey: AHJLHWRWDRCIKO-UHFFFAOYSA-N.
| Molecular formula | C9H6FNO2 |
|---|---|
| Molecular weight | 179.15 g/mol |
| IUPAC name | methyl 4-cyano-3-fluorobenzoate |
| InChIKey | AHJLHWRWDRCIKO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)C#N)F |
Computed by PubChem (NCBI)