Products 26889-96-3
CAS 26889-96-3 is the registry number for (R)-4-(4-Hydroxyphenyl)-2,5-oxazolidinedione. Offered by: Biosynth. Available pack sizes: 500mg.
(4R)-4-(4-hydroxyphenyl)-1,3-oxazolidine-2,5-dione (CAS 26889-96-3) is a chemical compound with the molecular formula C9H7NO4 and a molecular weight of 193.16 g/mol. IUPAC name: (4R)-4-(4-hydroxyphenyl)-1,3-oxazolidine-2,5-dione. InChIKey: CBVYRRXBGXLNRT-SSDOTTSWSA-N.
| Molecular formula | C9H7NO4 |
|---|---|
| Molecular weight | 193.16 g/mol |
| IUPAC name | (4R)-4-(4-hydroxyphenyl)-1,3-oxazolidine-2,5-dione |
| InChIKey | CBVYRRXBGXLNRT-SSDOTTSWSA-N |
| SMILES | C1=CC(=CC=C1[C@@H]2C(=O)OC(=O)N2)O |
Computed by PubChem (NCBI)