CAS 2694-54-4 appears in our catalog under these names: Triallyl benzene-1,2,4-tricarboxylate, 98%, Triallyl benzene-1,2,4-tricarboxylate, 95%+(LC-MS), 95%+(LC-MS), Triallyl benzene-1,2,4-tricarboxylate, 97% (stabilized with TBC), Triallyl benzene-1,2,4-tricarboxylate, 95% (stabilized with TBC). Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 100g, 500g.
Tris(prop-2-enyl) benzene-1,2,4-tricarboxylate (CAS 2694-54-4) is a chemical compound with the molecular formula C18H18O6 and a molecular weight of 330.3 g/mol. IUPAC name: tris(prop-2-enyl) benzene-1,2,4-tricarboxylate. InChIKey: GRPURDFRFHUDSP-UHFFFAOYSA-N.
| Molecular formula | C18H18O6 |
|---|---|
| Molecular weight | 330.3 g/mol |
| IUPAC name | tris(prop-2-enyl) benzene-1,2,4-tricarboxylate |
| InChIKey | GRPURDFRFHUDSP-UHFFFAOYSA-N |
| SMILES | C=CCOC(=O)C1=CC(=C(C=C1)C(=O)OCC=C)C(=O)OCC=C |
Computed by PubChem (NCBI)