CAS 2694026-62-3 is the registry number for 2-(2,6-dibromo-4-fluorophenyl)-1,3-dioxolane, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
2-(2,6-dibromo-4-fluorophenyl)-1,3-dioxolane (CAS 2694026-62-3) is a chemical compound with the molecular formula C9H7Br2FO2 and a molecular weight of 325.96 g/mol. IUPAC name: 2-(2,6-dibromo-4-fluorophenyl)-1,3-dioxolane. InChIKey: QOEWUHUYQIYHJH-UHFFFAOYSA-N.
| Molecular formula | C9H7Br2FO2 |
|---|---|
| Molecular weight | 325.96 g/mol |
| IUPAC name | 2-(2,6-dibromo-4-fluorophenyl)-1,3-dioxolane |
| InChIKey | QOEWUHUYQIYHJH-UHFFFAOYSA-N |
| SMILES | C1COC(O1)C2=C(C=C(C=C2Br)F)Br |
Computed by PubChem (NCBI)