CAS 26961-27-3 appears in our catalog under these names: 2-Amino-4,5-dimethoxybenzonitrile, >98.0%(GC), 2-Amino-4,5-dimethoxybenzonitrile 98%, 2-Amino-4,5-dimethoxybenzonitrile, 96%. Offered by: TCI, Ambeed, Fluorochem. Available pack sizes: 5g, 1g, 25g, 100g, 10g.
2-amino-4,5-dimethoxybenzonitrile (CAS 26961-27-3) is a chemical compound with the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. IUPAC name: 2-amino-4,5-dimethoxybenzonitrile. InChIKey: BJAYMNUBIULRMF-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O2 |
|---|---|
| Molecular weight | 178.19 g/mol |
| IUPAC name | 2-amino-4,5-dimethoxybenzonitrile |
| InChIKey | BJAYMNUBIULRMF-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)C#N)N)OC |
Computed by PubChem (NCBI)