Products 2696486-42-5

CAS 2696486-42-5 is the registry number for Roxadustat Impurity 85. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Ethyl 5-(4-phenoxyphenyl)-1,3-oxazole-4-carboxylate (CAS 2696486-42-5) is a chemical compound with the molecular formula C18H15NO4 and a molecular weight of 309.3 g/mol. IUPAC name: ethyl 5-(4-phenoxyphenyl)-1,3-oxazole-4-carboxylate. InChIKey: VQGDINXANIUHDU-UHFFFAOYSA-N.

Identity
Molecular formulaC18H15NO4
Molecular weight309.3 g/mol
IUPAC nameethyl 5-(4-phenoxyphenyl)-1,3-oxazole-4-carboxylate
InChIKeyVQGDINXANIUHDU-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(OC=N1)C2=CC=C(C=C2)OC3=CC=CC=C3

Computed by PubChem (NCBI)