CAS 27017-64-7 appears in our catalog under these names: 6-Methoxy-1,5-naphthyridin-2(1h)-one, 95%, 6-Methoxy-1,5-naphthyridin-2(1H)-one, 98%, 98%, 6-Methoxy-1,5-naphthyridin-2(1H)-one, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g.
6-methoxy-1H-1,5-naphthyridin-2-one (CAS 27017-64-7) is a chemical compound with the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. IUPAC name: 6-methoxy-1H-1,5-naphthyridin-2-one. InChIKey: ATXOFVYUYUQWME-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | 6-methoxy-1H-1,5-naphthyridin-2-one |
| InChIKey | ATXOFVYUYUQWME-UHFFFAOYSA-N |
| SMILES | COC1=NC2=C(C=C1)NC(=O)C=C2 |
Computed by PubChem (NCBI)