CAS 2703513-96-4 is the registry number for (R)-4-(1-(Methylamino)ethyl)benzoic acid hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
4-[(1R)-1-(methylamino)ethyl]benzoic acid;hydrochloride (CAS 2703513-96-4) is a chemical compound with the molecular formula C10H14ClNO2 and a molecular weight of 215.67 g/mol. IUPAC name: 4-[(1R)-1-(methylamino)ethyl]benzoic acid;hydrochloride. InChIKey: CEXZBQCTMVMLAQ-OGFXRTJISA-N.
| Molecular formula | C10H14ClNO2 |
|---|---|
| Molecular weight | 215.67 g/mol |
| IUPAC name | 4-[(1R)-1-(methylamino)ethyl]benzoic acid;hydrochloride |
| InChIKey | CEXZBQCTMVMLAQ-OGFXRTJISA-N |
| SMILES | C[C@H](C1=CC=C(C=C1)C(=O)O)NC.Cl |
Computed by PubChem (NCBI)