Products 2703513-96-4

CAS 2703513-96-4 is the registry number for (R)-4-(1-(Methylamino)ethyl)benzoic acid hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.

Structural formula: {0} (CAS {1})

4-[(1R)-1-(methylamino)ethyl]benzoic acid;hydrochloride (CAS 2703513-96-4) is a chemical compound with the molecular formula C10H14ClNO2 and a molecular weight of 215.67 g/mol. IUPAC name: 4-[(1R)-1-(methylamino)ethyl]benzoic acid;hydrochloride. InChIKey: CEXZBQCTMVMLAQ-OGFXRTJISA-N.

Identity
Molecular formulaC10H14ClNO2
Molecular weight215.67 g/mol
IUPAC name4-[(1R)-1-(methylamino)ethyl]benzoic acid;hydrochloride
InChIKeyCEXZBQCTMVMLAQ-OGFXRTJISA-N
SMILESC[C@H](C1=CC=C(C=C1)C(=O)O)NC.Cl

Computed by PubChem (NCBI)