CAS 2703773-52-6 is the registry number for 5-(2,4-Dioxotetrahydropyrimidin-1(2H)-yl)-2-methylbenzoic acid, 98%. Offered by: AmBeed. Available pack sizes: 1g.
5-(2,4-dioxo-1,3-diazinan-1-yl)-2-methylbenzoic acid (CAS 2703773-52-6) is a chemical compound with the molecular formula C12H12N2O4 and a molecular weight of 248.23 g/mol. IUPAC name: 5-(2,4-dioxo-1,3-diazinan-1-yl)-2-methylbenzoic acid. InChIKey: ZTHGIQALEUAWMN-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O4 |
|---|---|
| Molecular weight | 248.23 g/mol |
| IUPAC name | 5-(2,4-dioxo-1,3-diazinan-1-yl)-2-methylbenzoic acid |
| InChIKey | ZTHGIQALEUAWMN-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)N2CCC(=O)NC2=O)C(=O)O |
Computed by PubChem (NCBI)