CAS 27048-03-9 is the registry number for 6-Chloro-N-(1-methylethyl)-3-nitro-2-pyridinamine. Offered by: Chemat. Available pack sizes: 1g.
6-chloro-3-nitro-N-propan-2-ylpyridin-2-amine (CAS 27048-03-9) is a chemical compound with the molecular formula C8H10ClN3O2 and a molecular weight of 215.64 g/mol. IUPAC name: 6-chloro-3-nitro-N-propan-2-ylpyridin-2-amine. InChIKey: BGSQZFPLKFOJHL-UHFFFAOYSA-N.
| Molecular formula | C8H10ClN3O2 |
|---|---|
| Molecular weight | 215.64 g/mol |
| IUPAC name | 6-chloro-3-nitro-N-propan-2-ylpyridin-2-amine |
| InChIKey | BGSQZFPLKFOJHL-UHFFFAOYSA-N |
| SMILES | CC(C)NC1=C(C=CC(=N1)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)