Products 2704950-91-2
CAS 2704950-91-2 is the registry number for 6-methoxy-1-methyl-3H-pyrrolo[2,3-b]pyridin-2-one, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
6-methoxy-1-methyl-3H-pyrrolo[2,3-b]pyridin-2-one (CAS 2704950-91-2) is a chemical compound with the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. IUPAC name: 6-methoxy-1-methyl-3H-pyrrolo[2,3-b]pyridin-2-one. InChIKey: LUFBXERSBILQEJ-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O2 |
|---|---|
| Molecular weight | 178.19 g/mol |
| IUPAC name | 6-methoxy-1-methyl-3H-pyrrolo[2,3-b]pyridin-2-one |
| InChIKey | LUFBXERSBILQEJ-UHFFFAOYSA-N |
| SMILES | CN1C(=O)CC2=C1N=C(C=C2)OC |
Computed by PubChem (NCBI)