CAS 270596-38-8 appears in our catalog under these names: (S)-3-Amino-4-(3-chlorophenyl)butanoic acid, 95%, (S)–3–Amino–4–(3–chlorophenyl)butanoic acid, (S)-3-Amino-4-(3-chlorophenyl)butanoic acid, 97%, 97%, (S)-3-AMINO-4-(3-CHLOROPHENYL)BUTANOIC ACID, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 5g, 1g.
(3S)-3-amino-4-(3-chlorophenyl)butanoic acid (CAS 270596-38-8) is a chemical compound with the molecular formula C10H12ClNO2 and a molecular weight of 213.66 g/mol. IUPAC name: (3S)-3-amino-4-(3-chlorophenyl)butanoic acid. InChIKey: IWIJTZNQNXPKGN-VIFPVBQESA-N.
| Molecular formula | C10H12ClNO2 |
|---|---|
| Molecular weight | 213.66 g/mol |
| IUPAC name | (3S)-3-amino-4-(3-chlorophenyl)butanoic acid |
| InChIKey | IWIJTZNQNXPKGN-VIFPVBQESA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C[C@@H](CC(=O)O)N |
Computed by PubChem (NCBI)